For research use only. Not for therapeutic Use.
2,6-Difluorobenzenesulfonamide(Cat No.:L017511)is an aromatic sulfonamide compound featuring fluorine atoms at the 2- and 6-positions on a benzene ring. This compound is widely utilized in pharmaceutical research and organic synthesis as a key intermediate for the development of various bioactive molecules, including drugs and agrochemicals. The presence of fluorine atoms enhances the compound’s chemical reactivity and stability, making it valuable for modifying molecular structures. 2,6-Difluorobenzenesulfonamide plays a crucial role in advancing medicinal chemistry and the creation of innovative therapeutic agents.
CAS Number | 60230-37-7 |
Molecular Formula | C6H5F2NO2S |
Purity | ≥95% |
IUPAC Name | 2,6-difluorobenzenesulfonamide |
InChI | InChI=1S/C6H5F2NO2S/c7-4-2-1-3-5(8)6(4)12(9,10)11/h1-3H,(H2,9,10,11) |
InChIKey | RVVVGGCOFWWDEL-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)F)S(=O)(=O)N)F |