For research use only. Not for therapeutic Use.
(2,6-Difluoropyridin-3-yl)(phenyl)methanone(Cat No.:L002294)is a high-purity aromatic ketone, crucial for advanced pharmaceutical and chemical research. Featuring a difluoropyridine ring and a phenyl group connected by a methanone bridge, this compound is widely utilized as an intermediate in the synthesis of bioactive molecules, including drug candidates and agrochemicals. Its unique molecular structure offers selective reactivity, enabling diverse chemical transformations. With exceptional stability and reactivity, (2,6-Difluoropyridin-3-yl)(phenyl)methanone is ideal for precise synthetic applications, contributing to innovative research and development in medicinal chemistry.
CAS Number | 1158955-21-5 |
Molecular Formula | C12H7F2NO |
Purity | ≥95% |
IUPAC Name | (2,6-difluoropyridin-3-yl)-phenylmethanone |
InChI | InChI=1S/C12H7F2NO/c13-10-7-6-9(12(14)15-10)11(16)8-4-2-1-3-5-8/h1-7H |
InChIKey | INYPHEHCTMUQFS-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C(=O)C2=C(N=C(C=C2)F)F |