For research use only. Not for therapeutic Use.
2,6-Dihydroxynaphthalene is a high-purity aromatic compound used in organic synthesis and material science. This dihydroxy derivative of naphthalene is essential for studying redox reactions, synthesizing advanced dyes, and developing novel materials. Its precise composition ensures reliable and reproducible results, making it indispensable for advanced chemical synthesis and material science applications. Ideal for experimental setups, 2,6-Dihydroxynaphthalene enhances research accuracy and efficiency.
Catalog Number | R022931 |
CAS Number | 581-43-1 |
Synonyms | 2,6-Naphthalenediol; 2,6-Dihydroxynaphthaline; 2,6-Naphthohydroquinone; 2-Hydroxy-6-naphthol; 6-Hydroxy-2-naphthol; C.I. 76640; NSC 62687 |
Molecular Formula | C10H8O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | naphthalene-2,6-diol |
InChI | InChI=1S/C10H8O2/c11-9-3-1-7-5-10(12)4-2-8(7)6-9/h1-6,11-12H |
InChIKey | MNZMMCVIXORAQL-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CC(=C2)O)C=C1O |