For research use only. Not for therapeutic Use.
2,6-Diiodo-4-(trifluoromethyl)phenol(CAT: L027409) is a high-purity aromatic compound featuring a phenolic hydroxyl group, two iodine atoms, and a trifluoromethyl group. Its unique structure makes it a versatile intermediate in pharmaceutical research, agrochemical development, and material science. The diiodo substitution enhances its reactivity for further functionalization, such as cross-coupling reactions, while the trifluoromethyl group improves metabolic stability and lipophilicity in bioactive molecules. 2,6-Diiodo-4-(trifluoromethyl)phenol is ideal for synthesizing complex compounds, including small-molecule inhibitors and advanced fluorinated derivatives, offering precision and reliability for both academic and industrial applications in medicinal chemistry and fine chemical development.
CAS Number | 169255-50-9 |
Molecular Formula | C7H3F3I2O |
Purity | ≥95% |
IUPAC Name | 2,6-diiodo-4-(trifluoromethyl)phenol |
InChI | InChI=1S/C7H3F3I2O/c8-7(9,10)3-1-4(11)6(13)5(12)2-3/h1-2,13H |
InChIKey | PFTYBCBURDKLTH-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1I)O)I)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |