For research use only. Not for therapeutic Use.
2,6-Diisopropylaniline(Cat No.:R025252)is an aromatic amine widely used in organic synthesis and the production of agrochemicals and pharmaceuticals. Its bulky isopropyl groups confer steric hindrance, making it a valuable intermediate in the synthesis of complex molecules, including pesticides, herbicides, and active pharmaceutical ingredients (APIs). Additionally, it serves as a precursor in the manufacturing of dyes and pigments. High-purity 2,6-Diisopropylaniline is essential for ensuring the reliability and efficiency of chemical reactions, making it a critical component for researchers and manufacturers in advanced material and drug development.
CAS Number | 24544-04-5 |
Synonyms | 2,6-Diisopropyl- aniline; 2,6-Bis(1-methylethyl)aniline; 2,6-Bis(1-methylethyl)benzenamine; 2,6-Diisopropylphenylamine; N-(2,6-Diisopropylphenyl)amine |
Molecular Formula | C12H19N |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,6-di(propan-2-yl)aniline |
InChI | InChI=1S/C12H19N/c1-8(2)10-6-5-7-11(9(3)4)12(10)13/h5-9H,13H2,1-4H3 |
InChIKey | WKBALTUBRZPIPZ-UHFFFAOYSA-N |
SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |