For research use only. Not for therapeutic Use.
2,6-Diisopropylnaphthalene is a high-purity aromatic hydrocarbon essential for advanced pharmaceutical and chemical research. This naphthalene derivative is crucial for studies involving organic synthesis, material science, and chemical intermediates. Known for its stability and well-defined structure, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in diverse scientific applications.
CAS Number | 24157-81-1 |
Synonyms | 2,6-Bis(1-methylethyl)naphthalene; NSC 166467 |
Molecular Formula | C16H20 |
Purity | ≥95% |
Storage | Refrigerator |
IUPAC Name | 2,6-di(propan-2-yl)naphthalene |
InChI | InChI=1S/C16H20/c1-11(2)13-5-7-16-10-14(12(3)4)6-8-15(16)9-13/h5-12H,1-4H3 |
InChIKey | GWLLTEXUIOFAFE-UHFFFAOYSA-N |
SMILES | CC(C)C1=CC2=C(C=C1)C=C(C=C2)C(C)C |