For research use only. Not for therapeutic Use.
2,6-Diisopropylphenyl isocyanate(Cat No.:L006703), is a chemical compound featuring an isocyanate functional group attached to a 2,6-diisopropylphenyl ring. This compound is valuable in organic synthesis, serving as a reagent for the preparation of urethane and polyurethane compounds. Its specific structure and reactivity make it essential in the production of polymers, foams, coatings, and adhesives. Isocyanates are widely used in various industrial applications due to their ability to create durable materials.
CAS Number | 28178-42-9 |
Molecular Formula | C13H17NO |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 2-isocyanato-1,3-di(propan-2-yl)benzene |
InChI | InChI=1S/C13H17NO/c1-9(2)11-6-5-7-12(10(3)4)13(11)14-8-15/h5-7,9-10H,1-4H3 |
InChIKey | FEUFNKALUGDEMQ-UHFFFAOYSA-N |
SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)N=C=O |