For research use only. Not for therapeutic Use.
2,6-Dimethoxy-1,4-benzoquinone(Cat No.:R058893)is an organic compound derived from benzoquinone, notable for its antioxidant and redox properties. Found naturally in certain plants and fungi, it serves as a building block in chemical synthesis and is studied for its potential biological activities. This compound can participate in electron transfer processes, making it useful in research on redox reactions and cellular oxidative stress. Additionally, 2,6-Dimethoxy-1,4-benzoquinone has shown promise in studies related to cancer, antimicrobial, and enzyme inhibition, making it a valuable molecule in pharmacology and biochemical research.
CAS Number | 530-55-2 |
Molecular Formula | C8H8O4 |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | 2,6-dimethoxycyclohexa-2,5-diene-1,4-dione |
InChI | InChI=1S/C8H8O4/c1-11-6-3-5(9)4-7(12-2)8(6)10/h3-4H,1-2H3 |
InChIKey | OLBNOBQOQZRLMP-UHFFFAOYSA-N |
SMILES | COC1=CC(=O)C=C(C1=O)OC |