For research use only. Not for therapeutic Use.
2,6-DIMETHYL-3,5-HEPTANEDIONE (Cat.No:M074186) is a chemical compound with a unique structure. It is often employed in organic synthesis as a reagent or intermediate. This compound plays a crucial role in the creation of various complex organic molecules, making it valuable in pharmaceutical and chemical research and development.
CAS Number | 18362-64-6 |
Molecular Formula | C9H16O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,6-dimethylheptane-3,5-dione |
InChI | InChI=1S/C9H16O2/c1-6(2)8(10)5-9(11)7(3)4/h6-7H,5H2,1-4H3 |
InChIKey | CEGGECULKVTYMM-UHFFFAOYSA-N |
SMILES | CC(C)C(=O)CC(=O)C(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |