For research use only. Not for therapeutic Use.
2,6-Dimethylaniline-d11(Cat No.:R035311) is a high-purity deuterated compound essential for advanced research in organic chemistry and toxicology. Featuring eleven deuterium atoms, this isotopically labeled version of 2,6-Dimethylaniline is crucial for investigating metabolic pathways, reaction mechanisms, and environmental impact. Its precise isotope labeling ensures accurate and reliable analytical results, enhancing the quality of experimental data. 2,6-Dimethylaniline-d11 is widely used in studies involving aromatic amines, synthetic intermediates, and pollutant tracing.
CAS Number | 1092805-08-7 |
Synonyms | 2,6-Di(methyl-d3)benzen-3,4,5-d3-amine-d2 |
Molecular Formula | C8H11N |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | N,N,3,4,5-pentadeuterio-2,6-bis(trideuteriomethyl)aniline |
InChI | InChI=1S/C8H11N/c1-6-4-3-5-7(2)8(6)9/h3-5H,9H2,1-2H3/i1D3,2D3,3D,4D,5D/hD2 |
InChIKey | UFFBMTHBGFGIHF-MDCKYEMWSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])[2H])N([2H])[2H])C([2H])([2H])[2H])[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |