For research use only. Not for therapeutic Use.
2,6-Dimethylpiperazine (Cat.No:R019710) is a chemical compound used in various industrial applications. It serves as a building block in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure, containing two methyl groups and a piperazine ring, makes it valuable in diverse chemical processes and as a reagent in research and development.
Catalog Number | R019710 |
CAS Number | 108-49-6 |
Synonyms | 2,6-Dimethylpiperazine; 3,5-Dimethylpiperazine; NSC 49197 |
Molecular Formula | C6H14N2 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 2,6-dimethylpiperazine |
InChI | InChI=1S/C6H14N2/c1-5-3-7-4-6(2)8-5/h5-8H,3-4H2,1-2H3 |
InChIKey | IFNWESYYDINUHV-UHFFFAOYSA-N |
SMILES | CC1CNCC(N1)C |