For research use only. Not for therapeutic Use.
2,6-Heptanedione(Cat No.:M058688), also known as diacetylheptane, is a diketone compound with the chemical formula C7H12O2. It is characterized by its oily liquid form and distinct odor and is primarily used in organic synthesis as a building block for various chemical compounds. Its structure, featuring ketone groups at the second and sixth carbon atoms, allows for diverse reactivity, making it valuable in the synthesis of pharmaceuticals, fragrances, and other complex organic molecules. 2,6-Heptanedione is also used in research for studying enolization and hydrogen bonding due to its diketone functional groups.
CAS Number | 13505-34-5 |
Molecular Formula | C7H12O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | heptane-2,6-dione |
InChI | InChI=1S/C7H12O2/c1-6(8)4-3-5-7(2)9/h3-5H2,1-2H3 |
InChIKey | VAIFYHGFLAPCON-UHFFFAOYSA-N |
SMILES | CC(=O)CCCC(=O)C |