For research use only. Not for therapeutic Use.
2,6-Naphthalenedicarbonyl dichloride (Cat.No:L003728) is a pivotal chemical compound widely used in organic synthesis. Its structure, featuring naphthalene dicarbonyl groups, imparts unique reactivity and versatility. This compound is a key intermediate in the preparation of specialized organic molecules with applications in pharmaceuticals and materials science.
| Catalog Number | L003728 |
| CAS Number | 2351-36-2 |
| Molecular Formula | C12H6Cl2O2 |
| Purity | ≥95% |
| IUPAC Name | naphthalene-2,6-dicarbonyl chloride |
| InChI | InChI=1S/C12H6Cl2O2/c13-11(15)9-3-1-7-5-10(12(14)16)4-2-8(7)6-9/h1-6H |
| InChIKey | NZZGQZMNFCTNAM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C(=O)Cl)C=C1C(=O)Cl |
