For research use only. Not for therapeutic Use.
2,6-Naphthyridine(Cat No.:L006719), is a heterocyclic aromatic compound containing a naphthyridine ring with nitrogen atoms at the 2nd and 6th positions. This chemical structure is essential in medicinal chemistry, serving as a core scaffold in the development of various pharmaceuticals. Its unique aromaticity and reactivity make it valuable in the synthesis of bioactive molecules. Researchers leverage 2,6-naphthyridine as a key building block, contributing significantly to the development of anticancer agents, antibiotics, and other therapeutics. Its versatile properties enable the creation of diverse chemical entities, driving advancements in drug discovery and medicinal research.
CAS Number | 253-50-9 |
Molecular Formula | C8H6N2 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 2,6-naphthyridine |
InChI | InChI=1S/C8H6N2/c1-3-9-6-8-2-4-10-5-7(1)8/h1-6H |
InChIKey | SSNMISUJOQAFRR-UHFFFAOYSA-N |
SMILES | C1=CN=CC2=C1C=NC=C2 |