For research use only. Not for therapeutic Use.
2,6-Pyridinedimethanamine is an organic compound featuring a pyridine ring with two methanamine groups attached at the 2 and 6 positions. This unique structure enhances its reactivity and potential biological activity, making it valuable in medicinal chemistry. The amine groups can engage in various chemical reactions, including nucleophilic substitutions and couplings, allowing for further functionalization. This compound may serve as an important intermediate in the synthesis of pharmaceuticals, agrochemicals, and other bioactive molecules, particularly those targeting specific biological pathways.
CAS Number | 34984-16-2 |
Molecular Formula | C7H11N3 |
Purity | ≥95% |
IUPAC Name | [6-(aminomethyl)pyridin-2-yl]methanamine |
InChI | InChI=1S/C7H11N3/c8-4-6-2-1-3-7(5-9)10-6/h1-3H,4-5,8-9H2 |
InChIKey | SCAKSBRUOMUBFL-UHFFFAOYSA-N |
SMILES | C1=CC(=NC(=C1)CN)CN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |