For research use only. Not for therapeutic Use.
27-Deoxyactein is a high-purity natural compound used in pharmaceutical and biochemical research. This triterpene glycoside, derived from black cohosh, is essential for studying its potential therapeutic effects, including anti-inflammatory and hormone-regulating properties. Its precise composition ensures reliable and reproducible results, making it indispensable for drug development and natural product research. Ideal for experimental setups, 27-Deoxyactein enhances research accuracy and efficacy in various scientific investigations.
| Catalog Number | R023816 |
| CAS Number | 264624-38-6 |
| Synonyms | (3β,12β,16β,23S,24R,25R)-12-(Acetyloxy)-16,23:23,26:24,25-triepoxy-9,19-cyclolanostan-3-ylβ-D-Xylopyranoside; 26-Deoxyactein; 27-Deoxyactein |
| Molecular Formula | C37H56O10 |
| Purity | ≥95% |
| Target | Stem Cell/Wnt |
| Storage | Store at RT |
| InChI | InChI=1S/C37H56O10/c1-18-12-37(30-33(6,47-30)17-43-37)46-21-13-32(5)23-9-8-22-31(3,4)24(45-29-28(41)27(40)20(39)15-42-29)10-11-35(22)16-36(23,35)14-25(44-19(2)38)34(32,7)26(18)21/h18,20-30,39-41H,8-17H2,1-7H3/t18-,20-,21+,22+,23+,24+,25-,26+,27+,28-,29+,30-,32+,33-,34-,35-,36+,37+/m1/s1 |
| InChIKey | GCMGJWLOGKSUGX-RBKCHLQLSA-N |
| SMILES | CC1CC2(C3C(O3)(CO2)C)OC4C1C5(C(CC67CC68CCC(C(C8CCC7C5(C4)C)(C)C)OC9C(C(C(CO9)O)O)O)OC(=O)C)C |
