For research use only. Not for therapeutic Use.
2,7-Diazaspiro[3.5]nonan-1-one(Cat No.:L030735)is a high-purity spirocyclic compound widely used in pharmaceutical research and organic synthesis. This unique structure, featuring a spiro-connected nitrogen-containing ring system, is valuable for the development of bioactive molecules, particularly in the synthesis of complex heterocyclic compounds with therapeutic potential. Its versatile structure allows for selective modifications, making it essential in medicinal chemistry for exploring novel drug candidates. 2,7-Diazaspiro[3.5]nonan-1-one is crucial for research focused on optimizing synthetic pathways and advancing drug discovery efforts.
Catalog Number | L030735 |
CAS Number | 1147422-92-1 |
Molecular Formula | C7H12N2O |
Purity | ≥95% |
IUPAC Name | 2,7-diazaspiro[3.5]nonan-3-one |
InChI | InChI=1S/C7H12N2O/c10-6-7(5-9-6)1-3-8-4-2-7/h8H,1-5H2,(H,9,10) |
InChIKey | ZSJNNIPCNKKLHD-UHFFFAOYSA-N |
SMILES | C1CNCCC12CNC2=O |