For research use only. Not for therapeutic Use.
2,7-Dibromo-9H-thioxanthen-9-one(CAT: L000379) is a significant compound with relevance in material chemistry and organic synthesis. Its thioxanthone structure is essential in the field of photoinitiators for polymerization reactions, making it a key component for light-induced polymerization processes. In material chemistry, it can be used in the development of photosensitive materials and photopolymerization systems.
CAS Number | 40102-86-1 |
Molecular Formula | C13H6Br2OS |
Purity | ≥95% |
IUPAC Name | 2,7-dibromothioxanthen-9-one |
InChI | InChI=1S/C13H6Br2OS/c14-7-1-3-11-9(5-7)13(16)10-6-8(15)2-4-12(10)17-11/h1-6H |
InChIKey | MIGPGZSVGPGCCR-UHFFFAOYSA-N |