For research use only. Not for therapeutic Use.
2,7-Dimethoxy-9H-thioxanthen-9-one(CAT: L000439) is a compound that finds relevance in organic chemistry and material science. In organic chemistry, it serves as a versatile building block for the synthesis of various complex organic molecules, owing to its unique thioxanthone structure. This makes it an essential component for the diversification of chemical structures.
CAS Number | 435344-88-0 |
Molecular Formula | C15H12O3S |
Purity | ≥95% |
IUPAC Name | 2,7-dimethoxythioxanthen-9-one |
InChI | InChI=1S/C15H12O3S/c1-17-9-3-5-13-11(7-9)15(16)12-8-10(18-2)4-6-14(12)19-13/h3-8H,1-2H3 |
InChIKey | SQCBHRQQQSBAON-UHFFFAOYSA-N |