For research use only. Not for therapeutic Use.
2,7-Dimethylnaphthalene (CAT: R022962) is a chemical compound classified as a polycyclic aromatic hydrocarbon (PAH) and a derivative of naphthalene. It is a colorless to light yellow liquid with a distinct aromatic odor. This compound is often used as a starting material in organic synthesis, and it may also be found as a component in certain chemical reactions or processes where its specific properties, such as its aromatic nature or reactivity, are advantageous.
Catalog Number | R022962 |
CAS Number | 582-16-1 |
Synonyms | NSC 36851 |
Molecular Formula | C12H12 |
Purity | ≥95% |
Documentation | |
Storage | -20°C |
IUPAC Name | 2,7-dimethylnaphthalene |
InChI | InChI=1S/C12H12/c1-9-3-5-11-6-4-10(2)8-12(11)7-9/h3-8H,1-2H3 |
InChIKey | LRQYSMQNJLZKPS-UHFFFAOYSA-N |
SMILES | CC1=CC2=C(C=C1)C=CC(=C2)C |