For research use only. Not for therapeutic Use.
2,7-Dimethylocta-2,4,6-triene-1,8-dial is a highly reactive dialdehyde, crucial for advanced organic synthesis and chemical research. This compound is essential for studying complex chemical reactions, synthetic pathways, and the development of novel materials. Its unique structure allows for detailed analysis of reactivity and interaction with other molecules. 2,7-Dimethylocta-2,4,6-triene-1,8-dial is highly valued for its purity and stability, making it an indispensable tool in developing innovative compounds and advancing the field of organic chemistry.
Catalog Number | R035880 |
CAS Number | 5056-17-7 |
Synonyms | 2,7-Dimethyl-2,4,6-Octatrienedial; (2E,4E,6E)-2,7-Dimethyl-2,4,6-octatrienedial; (E,E,E)-2,7-Dimethyl-2,4,6-octatrien-1,8-dial; (E,E,E)-2,7-Dimethylocta-2,4,6-trienedial; (All-E)-2,7-Dimethyl-2,4,6-octatrienedial; 12,12’-Di-apo-carotenedial; All-E-2, |
Molecular Formula | C10H12O2 |
Purity | ≥95% |
IUPAC Name | (2E,4E,6E)-2,7-dimethylocta-2,4,6-trienedial |
InChI | InChI=1S/C10H12O2/c1-9(7-11)5-3-4-6-10(2)8-12/h3-8H,1-2H3/b4-3+,9-5+,10-6+ |
InChIKey | AYODHZHFDRRQEZ-XLKYRCCQSA-N |
SMILES | CC(=CC=CC=C(C)C=O)C=O |