For research use only. Not for therapeutic Use.
2,8-Dihydroxyadenine is a derivative of adenine, a fundamental component of DNA and RNA. This compound is notable in medical research for its role in adenine phosphoribosyltransferase deficiency, a rare genetic disorder leading to kidney stones and renal failure. Studying 2,8-dihydroxyadenine helps understand and develop treatments for related metabolic diseases, highlighting its significance in biochemical and clinical research.
Catalog Number | R044056 |
CAS Number | 30377-37-8 |
Synonyms | 6-Amino-7,9-dihydro-2H-purine-2,8(3H)-dione; 6-amino-1H-Purine-2,8(3H,7H)-dione; 6-Amino-purine-2,8-diol; 2,8-Dihydroxyadenine; 2,8-Dioxyadenine; 6-Amino-1H-purine-2,8(3H,7H)-dione; 6-Amino-2,8-dihydroxypurine |
Molecular Formula | C5H5N5O2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | 6-amino-7,9-dihydro-1H-purine-2,8-dione |
InChI | InChI=1S/C5H5N5O2/c6-2-1-3(9-4(11)7-1)10-5(12)8-2/h(H5,6,7,8,9,10,11,12) |
InChIKey | XFBOJHLYDJZYSP-UHFFFAOYSA-N |
SMILES | C12=C(NC(=O)N=C1NC(=O)N2)N |