For research use only. Not for therapeutic Use.
2,9-Dibutyl-1,10-phenanthroline(CAT: L017448) is a high-purity aromatic heterocyclic compound widely used in chemical, pharmaceutical, and material science research. Featuring a 1,10-phenanthroline core with butyl groups at the 2 and 9 positions, this compound exhibits unique electronic and steric properties, making it valuable in coordination chemistry and catalysis. Its robust structure is ideal for synthesizing metal complexes and studying ligand interactions. 2,9-Dibutyl-1,10-phenanthroline ensures reliable performance in experimental setups, supporting the development of innovative materials, catalysts, and bioactive molecules.
CAS Number | 85575-93-5 |
Molecular Formula | C20H24N2 |
Purity | ≥95% |
IUPAC Name | 2,9-dibutyl-1,10-phenanthroline |
InChI | InChI=1S/C20H24N2/c1-3-5-7-17-13-11-15-9-10-16-12-14-18(8-6-4-2)22-20(16)19(15)21-17/h9-14H,3-8H2,1-2H3 |
InChIKey | LSGGPELKXXFMGO-UHFFFAOYSA-N |
SMILES | CCCCC1=NC2=C(C=CC3=C2N=C(C=C3)CCCC)C=C1 |