2,9-Dimethyl-4,7-diphenyl-1,10-phenanthroline is a complex organic compound extensively utilized in analytical chemistry, particularly in metal ion detection and analysis. With its chelating properties, this molecule forms stable complexes with transition metal ions, facilitating their detection and quantification through spectrophotometric methods. Its specificity and sensitivity make it valuable in diverse fields including environmental monitoring, pharmaceutical analysis, and biochemical research, contributing significantly to advancements in analytical techniques.
| Catalog Number | R070533 |
| CAS Number | 4733-39-5 |
| Synonyms | Bathocuproine |
| Molecular Formula | C26H20N2 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline |
| InChI | InChI=1S/C26H20N2/c1-17-15-23(19-9-5-3-6-10-19)21-13-14-22-24(20-11-7-4-8-12-20)16-18(2)28-26(22)25(21)27-17/h3-16H,1-2H3 |
| InChIKey | STTGYIUESPWXOW-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC3=C2N=C(C=C3C4=CC=CC=C4)C)C(=C1)C5=CC=CC=C5 |
