For research use only. Not for therapeutic Use.
(2E)-3-(3,4-Dimethoxyphenyl)acryloyl chloride(Cat No.:L015302)is an organic compound used in pharmaceutical research and organic synthesis. The molecule features a cinnamoyl chloride structure with a 3,4-dimethoxyphenyl group, offering unique reactivity due to the presence of both the acryl chloride and the electron-donating methoxy groups. This compound is particularly valuable as an intermediate in the synthesis of complex molecules, including potential drug candidates and fine chemicals. Its structure allows for versatile chemical modifications, making it essential for researchers focused on drug discovery, medicinal chemistry, and the development of advanced materials.
CAS Number | 39856-08-1 |
Molecular Formula | C11H11ClO3 |
Purity | ≥95% |
IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl chloride |
InChI | InChI=1S/C11H11ClO3/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3-7H,1-2H3/b6-4+ |
InChIKey | HGDZRSNJGRIAKS-GQCTYLIASA-N |
SMILES | COC1=C(C=C(C=C1)C=CC(=O)Cl)OC |