Home
>
Reference Standards> (2E,4S)-4-Amino-5-[(3S)-2-oxo-3-pyrrolidinyl]-2-pentenoic Acid Ethyl Ester
For research use only. Not for therapeutic Use.
(2E,4S)-4-Amino-5-[(3S)-2-oxo-3-pyrrolidinyl]-2-pentenoic acid ethyl ester is a synthetic compound used in medicinal chemistry research. It combines an amino acid derivative with a pyrrolidinyl group and an ethyl ester, making it valuable for studying enzyme interactions and peptide synthesis. This compound’s unique structure aids in the development of new pharmaceuticals, particularly in targeting specific biochemical pathways and therapeutic applications.
CAS Number | 328086-61-9 |
Molecular Formula | C11H18N2O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | ethyl (E,4S)-4-amino-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate |
InChI | InChI=1S/C11H18N2O3/c1-2-16-10(14)4-3-9(12)7-8-5-6-13-11(8)15/h3-4,8-9H,2,5-7,12H2,1H3,(H,13,15)/b4-3+/t8-,9+/m0/s1 |
InChIKey | NLFHTKSVKMJEGA-DXMIZCBPSA-N |
SMILES | CCOC(=O)C=CC(CC1CCNC1=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |