For research use only. Not for therapeutic Use.
5-Bromo-1,3-dihydro-2H-inden-2-one(Cat No.:M036513) is a brominated derivative of inden-2-one, incorporating a bromine atom at the 5-position of the indene ring system. This compound belongs to the indene family, where the indene structure is fused with a ketonic group, providing significant chemical reactivity due to the conjugated system. The addition of a bromine atom increases its electrophilic character, making it useful in various chemical synthesis processes, particularly in the construction of more complex organic molecules. It serves as a valuable intermediate in the pharmaceutical and materials science industries for developing new compounds with enhanced properties.
CAS Number | 174349-93-0 |
Molecular Formula | C9H7BrO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-bromo-1,3-dihydroinden-2-one |
InChI | InChI=1S/C9H7BrO/c10-8-2-1-6-4-9(11)5-7(6)3-8/h1-3H,4-5H2 |
InChIKey | JQBSSMBLVVTRKJ-UHFFFAOYSA-N |
SMILES | C1C(=O)CC2=C1C=CC(=C2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |