For research use only. Not for therapeutic Use.
(2R)-2-{[(test-butoxy)carbonyl]amino}(Cat No.:L007433) is a chemical compound. Its molecular structure includes a tert-butoxycarbonyl (Boc) protected amino group attached to a chiral center, denoted by (2R), indicating the stereochemistry of the compound. This type of compound finds applications in various fields, including organic synthesis and pharmaceutical research, where the protection of amino groups is necessary to prevent unwanted reactions during chemical processes. The tert-butoxycarbonyl group acts as a protecting group, ensuring the specific modification of the target molecule.
CAS Number | 1354970-54-9 |
Molecular Formula | C12H17N3O4 |
Purity | ≥95% |
IUPAC Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyrimidin-5-ylpropanoic acid |
InChI | InChI=1S/C12H17N3O4/c1-12(2,3)19-11(18)15-9(10(16)17)4-8-5-13-7-14-6-8/h5-7,9H,4H2,1-3H3,(H,15,18)(H,16,17)/t9-/m1/s1 |
InChIKey | DHLBWJUPHCVNME-SECBINFHSA-N |
SMILES | CC(C)(C)OC(=O)NC(CC1=CN=CN=C1)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |