For research use only. Not for therapeutic Use.
(2R,3R)-N,N,N’,N’-Tetramethyltartramide is a chiral compound derived from tartramic acid, characterized by the presence of four methyl groups attached to the nitrogen atoms. This specific stereochemistry contributes to its unique properties and potential applications in various fields, including pharmaceuticals and organic synthesis. The presence of amide functional groups allows for hydrogen bonding and may enhance solubility in polar solvents. This compound can serve as a building block in the synthesis of more complex molecules, particularly in drug design and development.
CAS Number | 26549-65-5 |
Synonyms | Weinsaeure-bis-dimethylamid; 2,3-Dihydroxy-N,N,N’,N’-tetramethyl-succinamide; |
Molecular Formula | C8H16N2O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2R,3R)-2,3-dihydroxy-N,N,N/',N/'-tetramethylbutanediamide |
InChI | InChI=1S/C8H16N2O4/c1-9(2)7(13)5(11)6(12)8(14)10(3)4/h5-6,11-12H,1-4H3/t5-,6-/m1/s1 |
InChIKey | PCYDYHRBODKVEL-PHDIDXHHSA-N |
SMILES | CN(C)C(=O)C(C(C(=O)N(C)C)O)O |