Home
>
Chemical Reagents>Heterocyclic Building Blocks> (2R,4R)-4-Hydroxypyrrolidine-2-carboxamide hydrochloride
For research use only. Not for therapeutic Use.
(2R,4R)-4-Hydroxypyrrolidine-2-carboxamide hydrochloride(CAT: L000576) is a compound of significant importance in the fields of organic chemistry and pharmaceutical research. This chiral compound serves as a vital building block for the synthesis of various organic molecules, particularly in the development of pharmaceuticals and bioactive compounds. Its unique structure, featuring a pyrrolidine-2-carboxamide and a hydrochloride salt form, offers opportunities for structural modification and the creation of novel drugs with potential therapeutic benefits.
Catalog Number | L000576 |
CAS Number | 1844171-46-5 |
Molecular Formula | C5H11ClN2O2 |
Purity | ≥95% |
IUPAC Name | (2R,4R)-4-hydroxypyrrolidine-2-carboxamide;hydrochloride |
InChI | InChI=1S/C5H10N2O2.ClH/c6-5(9)4-1-3(8)2-7-4;/h3-4,7-8H,1-2H2,(H2,6,9);1H/t3-,4-;/m1./s1 |
InChIKey | OICPVUAPEGFLSK-VKKIDBQXSA-N |