Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> (2R,4S)-rel-tert-Butyl 4-amino-2-methylpiperidine-1-carboxylate
For research use only. Not for therapeutic Use.
(2R,4S)-rel-tert-Butyl 4-amino-2-methylpiperidine-1-carboxylate(Cat No.:L028184), is a chemical compound used in organic synthesis and pharmaceutical research. It is a piperidine derivative with a tert-butyl group attached to the nitrogen atom and an amino group at position 4. The compound also contains a carboxylate group and an additional methyl group on the piperidine ring. This versatile compound serves as a valuable intermediate in synthesizing various organic molecules and pharmaceutical agents, offering potential enhancements in biological activities or pharmacological properties.
CAS Number | 1434073-26-3 |
Molecular Formula | C11H22N2O2 |
Purity | ≥95% |
Storage | 2-8°C(protect from light) |
IUPAC Name | tert-butyl (2R,4S)-4-amino-2-methylpiperidine-1-carboxylate |
InChI | InChI=1S/C11H22N2O2/c1-8-7-9(12)5-6-13(8)10(14)15-11(2,3)4/h8-9H,5-7,12H2,1-4H3/t8-,9+/m1/s1 |
InChIKey | OGIPSHDJYIEDKG-BDAKNGLRSA-N |
SMILES | CC1CC(CCN1C(=O)OC(C)(C)C)N |