For research use only. Not for therapeutic Use.
(2R,5R)-2,5-Diphenylpyrrolidine(Cat No.:M097199) is a chiral pyrrolidine derivative characterized by the presence of phenyl groups at the 2 and 5 positions of the pyrrolidine ring. This specific stereochemistry, indicated by the (2R,5R) configuration, implies that both substituents are oriented in a specific spatial arrangement, which can significantly influence the compound’s chemical reactivity and interaction with biological systems. Such molecules are of interest in medicinal chemistry for their potential to act as building blocks in the synthesis of more complex molecules or as ligands in chiral recognition processes. The presence of phenyl groups typically enhances the molecule’s aromatic interactions and overall stability.
CAS Number | 155155-73-0 |
Molecular Formula | C16H17N |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | (2R,5R)-2,5-diphenylpyrrolidine |
InChI | InChI=1S/C16H17N/c1-3-7-13(8-4-1)15-11-12-16(17-15)14-9-5-2-6-10-14/h1-10,15-17H,11-12H2/t15-,16-/m1/s1 |
InChIKey | NAOGHMNKMJMMNQ-HZPDHXFCSA-N |
SMILES | C1CC(NC1C2=CC=CC=C2)C3=CC=CC=C3 |