For research use only. Not for therapeutic Use.
(2R,5S)-rel-Diethyl 2,5-dibromohexanedioate(Cat No.:L006885), is an organic compound used in chemical research and synthesis. Its molecular structure includes a dibromohexanedioate moiety with two ethyl groups. This compound is valuable as a key intermediate in the preparation of various organic derivatives. Researchers utilize it in the synthesis of complex molecules, including pharmaceuticals and specialty chemicals.
CAS Number | 54221-37-3 |
Molecular Formula | C10H16Br2O4 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | diethyl (2S,5R)-2,5-dibromohexanedioate |
InChI | InChI=1S/C10H16Br2O4/c1-3-15-9(13)7(11)5-6-8(12)10(14)16-4-2/h7-8H,3-6H2,1-2H3/t7-,8+ |
InChIKey | UBCNJHBDCUBIPB-OCAPTIKFSA-N |
SMILES | CCOC(=O)C(CCC(C(=O)OCC)Br)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |