For research use only. Not for therapeutic Use.
(2S)-2-(4-Bromophenyl)pyrrolidine is a chiral compound widely employed in pharmaceutical research, particularly in the synthesis of enantiomerically pure molecules. With its (2S) configuration, it introduces stereochemical complexity that is valuable in drug development, supporting the exploration of bioactive molecules with high selectivity and efficacy. The 4-bromophenyl group enhances its reactivity, making it an ideal intermediate in the synthesis of complex chemical frameworks. Its applications span medicinal chemistry, especially in the development of potential therapeutic agents and receptor-targeted studies.
CAS Number | 1189152-82-6 |
Molecular Formula | C10H12BrN |
Purity | ≥95% |
IUPAC Name | (2S)-2-(4-bromophenyl)pyrrolidine |
InChI | InChI=1S/C10H12BrN/c11-9-5-3-8(4-6-9)10-2-1-7-12-10/h3-6,10,12H,1-2,7H2/t10-/m0/s1 |
InChIKey | HIJZBROSVFKSCP-JTQLQIEISA-N |
SMILES | C1C[C@H](NC1)C2=CC=C(C=C2)Br |