For research use only. Not for therapeutic Use.
(2S)-2-amino-3-(6-pyridin-2-ylpyridin-3-yl)propanoic acid is a chemical compound characterized by an amino acid structure with a unique pyridine-containing side chain. The compound features an amino group, a central propanoic acid backbone, and two pyridine rings linked in a specific arrangement. This structure suggests potential applications in medicinal chemistry, particularly in designing molecules with specific receptor-binding properties or biological activities related to neurotransmission or signal transduction pathways involving pyridine-based ligands.
Catalog Number | R056513 |
CAS Number | 146581-79-5 |
Molecular Formula | C₁₃H₁₃N₃O₂ |
Purity | 95% |
Appearance | Off-White to Light Yellow Solid |
Related CAS | 1219368-79-2 |
IUPAC Name | (2S)-2-amino-3-(6-pyridin-2-ylpyridin-3-yl)propanoic acid |
InChI | InChI=1S/C13H13N3O2/c14-10(13(17)18)7-9-4-5-12(16-8-9)11-3-1-2-6-15-11/h1-6,8,10H,7,14H2,(H,17,18)/t10-/m0/s1 |
InChIKey | VWTQURBMIRJISI-JTQLQIEISA-N |
SMILES | C1=CC=NC(=C1)C2=NC=C(C=C2)CC(C(=O)O)N |