For research use only. Not for therapeutic Use.
(2S)-2-amino-6-methylamino-hexanoic acid(Cat No.:M049153) is a chiral amino acid derivative characterized by the presence of both amino and methylamino functional groups attached to a hexanoic acid backbone. This specific configuration involves an S-stereochemistry, indicating that the spatial arrangement of its atoms around the chiral center is in the S (sinister, or left-handed) configuration. It’s primarily used in biochemical and pharmaceutical research as a building block for synthesizing peptides and other complex organic molecules. Its structure and functional groups make it particularly interesting for modifications that enhance biological activity or absorption properties in drug development.
CAS Number | 1188-07-4 |
Molecular Formula | C7H16N2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S)-2-amino-6-(methylamino)hexanoic acid |
InChI | InChI=1S/C7H16N2O2/c1-9-5-3-2-4-6(8)7(10)11/h6,9H,2-5,8H2,1H3,(H,10,11)/t6-/m0/s1 |
InChIKey | PQNASZJZHFPQLE-LURJTMIESA-N |
SMILES | CNCCCCC(C(=O)O)N |