For research use only. Not for therapeutic Use.
(2S)-2-Aminobutyramide is an organic compound featuring an amide group and an amino group attached to a butane backbone. This chiral molecule, with its specific (S) configuration, is significant in pharmaceutical research and synthesis. It serves as a building block for developing various drugs and biologically active molecules, contributing to advancements in medicinal chemistry and drug design.
Catalog Number | R038763 |
CAS Number | 53726-14-0 |
Molecular Formula | C4H10N2O |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 2-aminobutanamide |
InChI | InChI=1S/C4H10N2O/c1-2-3(5)4(6)7/h3H,2,5H2,1H3,(H2,6,7) |
InChIKey | HNNJFUDLLWOVKZ-UHFFFAOYSA-N |
SMILES | CCC(C(=O)N)N |