For research use only. Not for therapeutic Use.
(2S)-2-Ethyl-8-methyl-1-thia-4,8-diazaspiro[4,5]decan-3-one is a spirocyclic compound with applications in medicinal chemistry and pharmaceutical research. Its unique spiro configuration, featuring a sulfur and nitrogen heterocyclic structure, makes it valuable for the design and development of bioactive molecules. The compound’s specific stereochemistry at the 2S position adds to its importance in creating chiral compounds for potential therapeutic use. Researchers utilize this compound in the synthesis of drug candidates, particularly in the exploration of novel chemical scaffolds for targeting specific biological pathways and improving drug efficacy in various therapeutic areas.
CAS Number | 503431-81-0 |
Synonyms | AF 267B; |
Molecular Formula | C10H18N2OS |
Purity | ≥95% |
Target | muscarinic M1 agonist |
Storage | Store at -20°C |
IUPAC Name | (2S)-2-ethyl-8-methyl-1-thia-4,8-diazaspiro[4.5]decan-3-one |
InChI | InChI=1S/C10H18N2OS/c1-3-8-9(13)11-10(14-8)4-6-12(2)7-5-10/h8H,3-7H2,1-2H3,(H,11,13)/t8-/m0/s1 |
InChIKey | PHOZOHFUXHPOCK-QMMMGPOBSA-N |
SMILES | CCC1C(=O)NC2(S1)CCN(CC2)C |