For research use only. Not for therapeutic Use.
(2S)-2-Hydroxyglutaric Acid Octyl Ester Sodium Salt is a chemical compound formed from the esterification of (2S)-2-hydroxyglutaric acid with octanol, followed by salt formation with sodium. This compound has potential applications in organic synthesis and biochemical research due to its specific structural properties. Its synthesis involves controlled chemical reactions under appropriate conditions to achieve the desired ester and salt formation, facilitating its use in various scientific investigations.
CAS Number | 1391067-96-1 |
Synonyms | (2S)-2-Hydroxypentanedioic Acid Octyl Ester Sodium Salt; (S)-2-Hydroxyglutaric Acid Octyl Ester Sodium Salt; (S)-α-Hydroxyglutaric Acid Octyl Ester Sodium Salt; L-2-Hydroxyglutaric Acid Octyl Ester Sodium Salt; Octyl L-2-Hydroxyglutarate Sodium Salt; |
Molecular Formula | C13H23NaO5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | sodium;(4S)-4-hydroxy-5-octoxy-5-oxopentanoate |
InChI | InChI=1S/C13H24O5.Na/c1-2-3-4-5-6-7-10-18-13(17)11(14)8-9-12(15)16;/h11,14H,2-10H2,1H3,(H,15,16);/q;+1/p-1/t11-;/m0./s1 |
InChIKey | UZUHAPHNUWGBFM-MERQFXBCSA-M |
SMILES | CCCCCCCCOC(=O)C(CCC(=O)[O-])O.[Na+] |