For research use only. Not for therapeutic Use.
(2S)-(+)-Glycidyl Tosylate (Cat.No:R047629) is a chiral compound used in organic synthesis as a versatile building block. Its tosylate group and glycidyl moiety make it valuable in creating complex molecules with specific stereochemistry. This compound serves as an intermediate in the production of various pharmaceuticals and fine chemicals.
Catalog Number | R047629 |
CAS Number | 70987-78-9 |
Synonyms | (2S)-2-Oxiranemethanol 2-(4-Methylbenzenesulfonate); (+)-Glycidyl Tosylate; (S)-(+)-Oxiran-2-ylmethyl 4-Methylbenzenesulfonate; (S)-Oxiran-2-ylmethyl Toluene-4-sulfonate; (S)-Toluene-4-sulfonic Scid Oxiranylmethyl Ester; (S)-(2,3-Epoxypropan-1-yl) 4 |
Molecular Formula | C10H12O4S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [(2S)-oxiran-2-yl]methyl 4-methylbenzenesulfonate |
InChI | InChI=1S/C10H12O4S/c1-8-2-4-10(5-3-8)15(11,12)14-7-9-6-13-9/h2-5,9H,6-7H2,1H3/t9-/m0/s1 |
InChIKey | NOQXXYIGRPAZJC-VIFPVBQESA-N |
SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2CO2 |