Home
>
Bioactive Chemicals>Amino acids> (2S)-Isopropyl 2-(((perfluorophenoxy)(phenoxy)phosphoryl)amino)propanoate
For research use only. Not for therapeutic Use.
(2S)-Isopropyl 2-(((perfluorophenoxy)(phenoxy)phosphoryl)amino)propanoate(Cat No.:L028229)is a specialized compound used in advanced organic synthesis and pharmaceutical research. This molecule features a chiral propanoate backbone with isopropyl and phosphoramidate groups, incorporating both perfluorophenoxy and phenoxy substituents. Its unique structure makes it valuable for developing new chemical entities, particularly in the synthesis of fluorinated compounds with potential applications in drug discovery. The compound’s fluorinated phenyl groups enhance its reactivity and stability, making it essential for creating complex molecules in medicinal chemistry.
CAS Number | 1256490-52-4 |
Molecular Formula | C18H17F5NO5P |
Purity | ≥95% |
IUPAC Name | propan-2-yl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate |
InChI | InChI=1S/C18H17F5NO5P/c1-9(2)27-18(25)10(3)24-30(26,28-11-7-5-4-6-8-11)29-17-15(22)13(20)12(19)14(21)16(17)23/h4-10H,1-3H3,(H,24,26)/t10-,30?/m0/s1 |
InChIKey | MIILDBHEJQLACD-KPORQTCDSA-N |
SMILES | CC(C)OC(=O)C(C)NP(=O)(OC1=CC=CC=C1)OC2=C(C(=C(C(=C2F)F)F)F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |