For research use only. Not for therapeutic Use.
(2S,2’S)-2,2′-(Hexadecanedioylbis(azanediyl))dipentanedioic acid(CAT: L000557) is a compound of significance in the fields of organic chemistry and material chemistry. This molecule’s unique structure, with its azanediyl and pentanedioic acid groups, makes it valuable for diverse applications. In organic chemistry, it serves as a versatile intermediate for the synthesis of complex organic compounds, with potential applications in drug development.
CAS Number | 1255861-91-6 |
Molecular Formula | C26H44N2O10 |
Purity | ≥95% |
IUPAC Name | (2S)-2-[[16-[[(1S)-1,3-dicarboxypropyl]amino]-16-oxohexadecanoyl]amino]pentanedioic acid |
InChI | InChI=1S/C26H44N2O10/c29-21(27-19(25(35)36)15-17-23(31)32)13-11-9-7-5-3-1-2-4-6-8-10-12-14-22(30)28-20(26(37)38)16-18-24(33)34/h19-20H,1-18H2,(H,27,29)(H,28,30)(H,31,32)(H,33,34)(H,35,36)(H,37,38)/t19-,20-/m0/s1 |
InChIKey | ILUVQABKXSFQSU-PMACEKPBSA-N |