For research use only. Not for therapeutic Use.
(S,3aR,7aS)-Octahydroindole-2-carboxylic Acid (Cat.No:R024583) is a chemical compound with potential applications in organic synthesis and medicinal chemistry. Its unique structure contains an octahydroindole ring system and a carboxylic acid group. This compound serves as a valuable building block in the creation of diverse molecules for various research purposes.
| CAS Number | 145438-94-4 |
| Synonyms | rel-(2S, 3aR,7aS)-Octahydro-1H-indole-2-carboxylic Acid; (2α,3aα,7aβ)-Octahydro-1H-indole-2-carboxylic Acid; |
| Molecular Formula | C9H15NO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2S,3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid |
| InChI | InChI=1S/C9H15NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h6-8,10H,1-5H2,(H,11,12)/t6-,7+,8+/m1/s1 |
| InChIKey | CQYBNXGHMBNGCG-CSMHCCOUSA-N |
| SMILES | C1CCC2C(C1)CC(N2)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
