For research use only. Not for therapeutic Use.
(2S,3R)-3-Aminobutan-2-ol hydrochloride (Cat.No:L004148) is a crucial chiral compound with applications in pharmaceutical and chemical research. Its unique stereochemistry imparts distinct reactivity and biological properties. This compound serves as a valuable intermediate in the synthesis of specialized molecules with potential pharmaceutical activity. Its versatile nature and specific attributes make it a key building block in the development of innovative drugs, underscoring its significance in contemporary medicinal chemistry and drug discovery endeavors.
CAS Number | 1605313-24-3 |
Molecular Formula | C4H12ClNO |
Purity | ≥95% |
IUPAC Name | (2S,3R)-3-aminobutan-2-ol;hydrochloride |
InChI | InChI=1S/C4H11NO.ClH/c1-3(5)4(2)6;/h3-4,6H,5H2,1-2H3;1H/t3-,4+;/m1./s1 |
InChIKey | VREIZDQPOMNWLM-HJXLNUONSA-N |
SMILES | C[C@H]([C@H](C)O)N.Cl |