Home
>
Chemical Reagents>Heterocyclic Building Blocks> (2S,3R)-3-hydroxypiperidine-2-carboxylic Acid Hydrochloride
For research use only. Not for therapeutic Use.
(2S,3R)-3-hydroxypiperidine-2-carboxylic Acid Hydrochloride (Cat.No:L003328) is a crucial chemical compound in pharmaceutical research. Its specific stereochemistry lends itself to the synthesis of biologically active molecules, making it valuable in drug development. This compound plays a pivotal role in advancing medical science and the creation of innovative therapeutics.
CAS Number | 870651-01-7 |
Molecular Formula | C6H12ClNO3 |
Purity | ≥95% |
IUPAC Name | (2S,3R)-3-hydroxypiperidine-2-carboxylic acid;hydrochloride |
InChI | InChI=1S/C6H11NO3.ClH/c8-4-2-1-3-7-5(4)6(9)10;/h4-5,7-8H,1-3H2,(H,9,10);1H/t4-,5+;/m1./s1 |
InChIKey | ABMGIZHBKVDDRD-JBUOLDKXSA-N |
SMILES | C1C[C@H]([C@H](NC1)C(=O)O)O.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |