Home
>
Catalysts and Ligands>Chiral phosphine ligands>
>
(2S,3S)-3-(tert-Butyl)-4-(2,6-dimethoxyphenyl)-2-ethyl-2,3-dihydrobenzo[d][1,3]oxaphosphole
For research use only. Not for therapeutic Use.
(2S,3S)-3-(tert-Butyl)-4-(2,6-dimethoxyphenyl)-2-ethyl-2,3-dihydrobenzo[d][1,3]oxaphosphole (Cat.No:L003808) is a crucial compound in organic synthesis. Its intricate structure, featuring a benzo[d][1,3]oxaphosphole scaffold, imparts unique reactivity and properties. This compound holds promise in the development of specialized materials and pharmaceuticals. Its versatile nature makes it an essential building block for innovative products across industries, underscoring its significance in contemporary chemical research.
Catalog Number | L003808 |
CAS Number | 2247162-97-4 |
Molecular Formula | C21H27O3P |
Purity | ≥95% |
IUPAC Name | (2S,3S)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2-ethyl-2H-1,3-benzoxaphosphole |
InChI | InChI=1S/C21H27O3P/c1-7-18-24-17-13-8-10-14(20(17)25(18)21(2,3)4)19-15(22-5)11-9-12-16(19)23-6/h8-13,18H,7H2,1-6H3/t18-,25+/m0/s1 |
InChIKey | MOKJPWHEQPXKKI-AVRWGWEMSA-N |
SMILES | CC[C@H]1OC2=CC=CC(=C2[P@@]1C(C)(C)C)C3=C(C=CC=C3OC)OC |