Home
>
Reference Standards> (2S,3S,5S)-2-(2,6-Dimethylphenoxyacetyl)amino-3-hydroxy-5-amino-1,6-diphenylhexane
For research use only. Not for therapeutic Use.
(2S,3S,5S)-2-(2,6-Dimethylphenoxyacetyl)amino-3-hydroxy-5-amino-1,6-diphenylhexane is a chiral compound used in pharmaceutical research, particularly in the development of bioactive molecules. Its complex structure, featuring both hydroxyl and amino groups, along with phenyl and dimethylphenoxyacetyl groups, makes it useful in studying interactions with biological targets. The stereochemistry of the molecule plays a crucial role in its binding affinity and specificity, making it valuable for medicinal chemistry applications, such as drug discovery and therapeutic development.
CAS Number | 192725-49-8 |
Synonyms | N-[(1S,2S,4S)-4-amino-2-hydroxy-5-phenyl-1-(phenylmethyl)pentyl]-2-(2,6-dimethylphenoxy)Acetamide |
Molecular Formula | C28H34N2O3 |
Purity | ≥95% |
Storage | Desiccate at +4 ℃ |
IUPAC Name | N-[(2S,3S,5S)-5-amino-3-hydroxy-1,6-diphenylhexan-2-yl]-2-(2,6-dimethylphenoxy)acetamide |
InChI | InChI=1S/C28H34N2O3/c1-20-10-9-11-21(2)28(20)33-19-27(32)30-25(17-23-14-7-4-8-15-23)26(31)18-24(29)16-22-12-5-3-6-13-22/h3-15,24-26,31H,16-19,29H2,1-2H3,(H,30,32)/t24-,25-,26-/m0/s1 |
InChIKey | LWXUXIDLCWPHIW-GSDHBNRESA-N |
SMILES | CC1=C(C(=CC=C1)C)OCC(=O)NC(CC2=CC=CC=C2)C(CC(CC3=CC=CC=C3)N)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |