Home
>
Chemical Reagents>Heterocyclic Building Blocks> (2S,4R)-1-tert-Butyl 2-methyl 4-fluoropyrrolidine-1,2-dicarboxylate
For research use only. Not for therapeutic Use.
(2S,4R)-1-tert-Butyl 2-methyl 4-fluoropyrrolidine-1,2-dicarboxylate is a chiral pyrrolidine derivative characterized by a tert-butyl group at the 1-position, a methyl group at the 2-position, and a fluorine atom at the 4-position. This compound features two carboxylate functionalities, enhancing its reactivity and potential for various chemical transformations. Its unique stereochemistry makes it of interest in medicinal chemistry, where it may serve as a scaffold for developing novel therapeutics. The structure allows for further modifications to explore structure-activity relationships.
CAS Number | 203866-18-6 |
Molecular Formula | C11H18FNO4 |
Purity | ≥95% |
IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-fluoropyrrolidine-1,2-dicarboxylate |
InChI | InChI=1S/C11H18FNO4/c1-11(2,3)17-10(15)13-6-7(12)5-8(13)9(14)16-4/h7-8H,5-6H2,1-4H3/t7-,8+/m1/s1 |
InChIKey | METPQQHVRNLTRX-SFYZADRCSA-N |
SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)OC)F |