Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
(2S,4R)-4-(((Benzyloxy)carbonyl)amino)pyrrolidine-2-carboxylic acid
For research use only. Not for therapeutic Use.
(2S,4R)-4-(((Benzyloxy)carbonyl)amino)pyrrolidine-2-carboxylic acid (Cat.No:L003709) is a crucial compound in medicinal chemistry. Its chiral nature and unique structure make it a significant building block for the synthesis of pharmaceutical agents. This compound’s specific arrangement of atoms grants it distinct biological activity, making it a key intermediate in the development of innovative drugs.
Catalog Number | L003709 |
CAS Number | 1279039-31-4 |
Molecular Formula | C13H16N2O4 |
Purity | ≥95% |
IUPAC Name | (2S,4R)-4-(phenylmethoxycarbonylamino)pyrrolidine-2-carboxylic acid |
InChI | InChI=1S/C13H16N2O4/c16-12(17)11-6-10(7-14-11)15-13(18)19-8-9-4-2-1-3-5-9/h1-5,10-11,14H,6-8H2,(H,15,18)(H,16,17)/t10-,11+/m1/s1 |
InChIKey | VCZIKOUKWSDDIU-MNOVXSKESA-N |
SMILES | C1[C@H](CN[C@@H]1C(=O)O)NC(=O)OCC2=CC=CC=C2 |