Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
(2S,4S)-1-(tert-Butoxycarbonyl)-4-(difluoromethyl)pyrrolidine-2-carboxylic acid
For research use only. Not for therapeutic Use.
(2S,4S)-1-(tert-Butoxycarbonyl)-4-(difluoromethyl)pyrrolidine-2-carboxylic acid(Cat No.:L037869)is a chiral compound widely used in pharmaceutical research and organic synthesis. Featuring a difluoromethyl group and a Boc-protected pyrrolidine ring, this compound is a crucial intermediate in the synthesis of complex molecules, particularly in the development of enantiomerically pure drugs. Its unique stereochemistry and functional groups allow for precise chemical modifications, making it valuable in creating new therapeutic agents. (2S,4S)-1-(tert-Butoxycarbonyl)-4-(difluoromethyl)pyrrolidine-2-carboxylic acid supports high-precision synthesis in medicinal chemistry.
Catalog Number | L037869 |
CAS Number | 474417-79-3 |
Molecular Formula | C11H17F2NO4 |
Purity | ≥95% |
IUPAC Name | (2S,4S)-4-(difluoromethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
InChI | InChI=1S/C11H17F2NO4/c1-11(2,3)18-10(17)14-5-6(8(12)13)4-7(14)9(15)16/h6-8H,4-5H2,1-3H3,(H,15,16)/t6-,7-/m0/s1 |
InChIKey | MYGMUZRVGABZMM-BQBZGAKWSA-N |
SMILES | CC(C)(C)OC(=O)N1CC(CC1C(=O)O)C(F)F |